C34H40N4O9 — CID 67122735
(2S)-2-[[[(2-methylpropan-2-yl)oxycarbonylamino]-(3-phenylmethoxycarbonylphenyl)carbamoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 67122735) has the molecular formula C34H40N4O9 and a molecular weight of 648.71 g/mol. Its IUPAC name is (2S)-2-[[[(2-methylpropan-2-yl)oxycarbonylamino]-(3-phenylmethoxycarbonylphenyl)carbamoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-[[[(2-methylpropan-2-yl)oxycarbonylamino]-(3-phenylmethoxycarbonylphenyl)carbamoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 67122735 |
| Molecular Formula | C34H40N4O9 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | (2S)-2-[[[(2-methylpropan-2-yl)oxycarbonylamino]-(3-phenylmethoxycarbonylphenyl)carbamoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)O)c1cccc(C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C34H40N4O9/c1-34(2,3)47-33(44)37-38(27-18-12-17-26(21-27)30(41)45-22-24-13-6-4-7-14-24)31(42)36-28(29(39)40)19-10-11-20-35-32(43)46-23-25-15-8-5-9-16-25/h4-9,12-18,21,28H,10-11,19-20,22-23H2,1-3H3,(H,35,43)(H,36,42)(H,37,44)(H,39,40)/t28-/m0/s1 |
| InChIKey | SJBOUXXWSPIGLO-NDEPHWFRSA-N |
| XLogP | 5.55 |
| TPSA | 172.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|