C39H51N5O9 — CID 46843160
[benzyl-[[(2-methylpropan-2-yl)oxycarbonylamino]-(3-phenylmethoxycarbonylphenyl)carbamoyl]amino]-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid (PubChem CID 46843160) has the molecular formula C39H51N5O9 and a molecular weight of 733.86 g/mol. Its IUPAC name is [benzyl-[[(2-methylpropan-2-yl)oxycarbonylamino]-(3-phenylmethoxycarbonylphenyl)carbamoyl]amino]-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid.
| Compound Name | [benzyl-[[(2-methylpropan-2-yl)oxycarbonylamino]-(3-phenylmethoxycarbonylphenyl)carbamoyl]amino]-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid |
|---|---|
| PubChem CID | 46843160 |
| Molecular Formula | C39H51N5O9 |
| Molecular Weight | 733.86 g/mol |
| Exact Mass | 733.37 |
| IUPAC Name | [benzyl-[[(2-methylpropan-2-yl)oxycarbonylamino]-(3-phenylmethoxycarbonylphenyl)carbamoyl]amino]-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCCCN(C(=O)O)N(Cc1ccccc1)C(=O)N(NC(=O)OC(C)(C)C)c1cccc(C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C39H51N5O9/c1-38(2,3)52-34(46)40-24-15-7-8-16-25-42(37(49)50)43(27-29-18-11-9-12-19-29)36(48)44(41-35(47)53-39(4,5)6)32-23-17-22-31(26-32)33(45)51-28-30-20-13-10-14-21-30/h9-14,17-23,26H,7-8,15-16,24-25,27-28H2,1-6H3,(H,40,46)(H,41,47)(H,49,50) |
| InChIKey | ZEOVCOQXLYQBGV-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 167.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.86 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|