C16H14F3NO2 — CID 135373989
8-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-4-amine (PubChem CID 135373989) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is 8-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 8-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 135373989 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 8-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1CCOc2c(Oc3ccc(C(F)(F)F)cc3)cccc21 |
| InChI | InChI=1S/C16H14F3NO2/c17-16(18,19)10-4-6-11(7-5-10)22-14-3-1-2-12-13(20)8-9-21-15(12)14/h1-7,13H,8-9,20H2 |
| InChIKey | BCYJXXJKZKWLBH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |