C20H18F3NO3 — CID 135374002
N-[8-methyl-7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-4-yl]prop-2-enamide (PubChem CID 135374002) has the molecular formula C20H18F3NO3 and a molecular weight of 377.36 g/mol. Its IUPAC name is N-[8-methyl-7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-4-yl]prop-2-enamide.
| Compound Name | N-[8-methyl-7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135374002 |
| Molecular Formula | C20H18F3NO3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[8-methyl-7-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCOc2c1ccc(Oc1ccc(C(F)(F)F)cc1)c2C |
| InChI | InChI=1S/C20H18F3NO3/c1-3-18(25)24-16-10-11-26-19-12(2)17(9-8-15(16)19)27-14-6-4-13(5-7-14)20(21,22)23/h3-9,16H,1,10-11H2,2H3,(H,24,25) |
| InChIKey | BDPUINNUKBELPL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|