C20H17F3O3 — CID 147127027
1-[5-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-3-yl]but-3-en-2-one (PubChem CID 147127027) has the molecular formula C20H17F3O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is 1-[5-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-3-yl]but-3-en-2-one.
| Compound Name | 1-[5-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 147127027 |
| Molecular Formula | C20H17F3O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 1-[5-[4-(trifluoromethyl)phenoxy]-3,4-dihydro-2H-chromen-3-yl]but-3-en-2-one |
| SMILES | C=CC(=O)CC1COc2cccc(Oc3ccc(C(F)(F)F)cc3)c2C1 |
| InChI | InChI=1S/C20H17F3O3/c1-2-15(24)10-13-11-17-18(25-12-13)4-3-5-19(17)26-16-8-6-14(7-9-16)20(21,22)23/h2-9,13H,1,10-12H2 |
| InChIKey | BPMINAAJNNFDKW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|