C13H24N3O4P — CID 135379825
[1-[tert-butyl(2-cyanopropan-2-yloxy)amino]-2-cyano-2-methylpropyl]phosphonic acid (PubChem CID 135379825) has the molecular formula C13H24N3O4P and a molecular weight of 317.33 g/mol. Its IUPAC name is [1-[tert-butyl(2-cyanopropan-2-yloxy)amino]-2-cyano-2-methylpropyl]phosphonic acid.
| Compound Name | [1-[tert-butyl(2-cyanopropan-2-yloxy)amino]-2-cyano-2-methylpropyl]phosphonic acid |
|---|---|
| PubChem CID | 135379825 |
| Molecular Formula | C13H24N3O4P |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | [1-[tert-butyl(2-cyanopropan-2-yloxy)amino]-2-cyano-2-methylpropyl]phosphonic acid |
| SMILES | CC(C)(C#N)ON(C(C(C)(C)C#N)P(=O)(O)O)C(C)(C)C |
| InChI | InChI=1S/C13H24N3O4P/c1-11(2,3)16(20-13(6,7)9-15)10(21(17,18)19)12(4,5)8-14/h10H,1-7H3,(H2,17,18,19) |
| InChIKey | LLVYVUGSIDWMNN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|