C7H5ClN4S — CID 135396794
5-(5-chloro-1,3,4-thiadiazol-2-yl)pyridin-2-amine (PubChem CID 135396794) has the molecular formula C7H5ClN4S and a molecular weight of 212.67 g/mol. Its IUPAC name is 5-(5-chloro-1,3,4-thiadiazol-2-yl)pyridin-2-amine.
| Compound Name | 5-(5-chloro-1,3,4-thiadiazol-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 135396794 |
| Molecular Formula | C7H5ClN4S |
| Molecular Weight | 212.67 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 5-(5-chloro-1,3,4-thiadiazol-2-yl)pyridin-2-amine |
| SMILES | Nc1ccc(-c2nnc(Cl)s2)cn1 |
| InChI | InChI=1S/C7H5ClN4S/c8-7-12-11-6(13-7)4-1-2-5(9)10-3-4/h1-3H,(H2,9,10) |
| InChIKey | UTTNTEVIQQBLNS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.67 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |