C11H12N6O4 — CID 135400466
1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]urea (PubChem CID 135400466) has the molecular formula C11H12N6O4 and a molecular weight of 292.26 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]urea.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 135400466 |
| Molecular Formula | C11H12N6O4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]urea |
| SMILES | COc1cc(/C=N\NC(=O)Nc2nonc2N)ccc1O |
| InChI | InChI=1S/C11H12N6O4/c1-20-8-4-6(2-3-7(8)18)5-13-15-11(19)14-10-9(12)16-21-17-10/h2-5,18H,1H3,(H2,12,16)(H2,14,15,17,19)/b13-5- |
| InChIKey | WSNSZUWXQSALIL-ACAGNQJTSA-N |
| XLogP | 0.52 |
| TPSA | 147.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|