C16H12ClN3O3S2 — CID 135400723
N-[C-[3-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-hydroxycarbonimidoyl]thiophene-2-carboxamide (PubChem CID 135400723) has the molecular formula C16H12ClN3O3S2 and a molecular weight of 393.88 g/mol. Its IUPAC name is N-[C-[3-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-hydroxycarbonimidoyl]thiophene-2-carboxamide.
| Compound Name | N-[C-[3-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-hydroxycarbonimidoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135400723 |
| Molecular Formula | C16H12ClN3O3S2 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | N-[C-[3-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-hydroxycarbonimidoyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=NO)c1cccc(OCc2cnc(Cl)s2)c1)c1cccs1 |
| InChI | InChI=1S/C16H12ClN3O3S2/c17-16-18-8-12(25-16)9-23-11-4-1-3-10(7-11)14(20-22)19-15(21)13-5-2-6-24-13/h1-8,22H,9H2,(H,19,20,21) |
| InChIKey | ZFKTVJJJSNKSSA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|