C17H12N4O2S — CID 135404753
2-methylsulfanyl-3-[(E)-(2-oxo-1H-indol-3-ylidene)amino]quinazolin-4-one (PubChem CID 135404753) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-methylsulfanyl-3-[(E)-(2-oxo-1H-indol-3-ylidene)amino]quinazolin-4-one.
| Compound Name | 2-methylsulfanyl-3-[(E)-(2-oxo-1H-indol-3-ylidene)amino]quinazolin-4-one |
|---|---|
| PubChem CID | 135404753 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-methylsulfanyl-3-[(E)-(2-oxo-1H-indol-3-ylidene)amino]quinazolin-4-one |
| SMILES | CSc1nc2ccccc2c(=O)n1/N=C1/C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C17H12N4O2S/c1-24-17-19-13-9-5-3-7-11(13)16(23)21(17)20-14-10-6-2-4-8-12(10)18-15(14)22/h2-9H,1H3,(H,18,20,22) |
| InChIKey | TXRPNAMOSJVNPN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|