C9H5FN4S — CID 135408001
9-fluoro-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione (PubChem CID 135408001) has the molecular formula C9H5FN4S and a molecular weight of 220.23 g/mol. Its IUPAC name is 9-fluoro-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione.
| Compound Name | 9-fluoro-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione |
|---|---|
| PubChem CID | 135408001 |
| Molecular Formula | C9H5FN4S |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 9-fluoro-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione |
| SMILES | Fc1cccc2[nH]c3nc(=S)[nH]nc3c12 |
| InChI | InChI=1S/C9H5FN4S/c10-4-2-1-3-5-6(4)7-8(11-5)12-9(15)14-13-7/h1-3H,(H2,11,12,14,15) |
| InChIKey | VTOMSBFSYYHZPM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|