C36H32CuN8O6S2 — CID 135409898
copper;bis(1-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]-3-(4-phenyl-1,3-thiazol-2-yl)urea) (PubChem CID 135409898) has the molecular formula C36H32CuN8O6S2 and a molecular weight of 800.38 g/mol. Its IUPAC name is copper;bis(1-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]-3-(4-phenyl-1,3-thiazol-2-yl)urea).
| Compound Name | copper;bis(1-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]-3-(4-phenyl-1,3-thiazol-2-yl)urea) |
|---|---|
| PubChem CID | 135409898 |
| Molecular Formula | C36H32CuN8O6S2 |
| Molecular Weight | 800.38 g/mol |
| Exact Mass | 799.12 |
| IUPAC Name | copper;bis(1-[(Z)-1-(2,4-dihydroxyphenyl)ethylideneamino]-3-(4-phenyl-1,3-thiazol-2-yl)urea) |
| SMILES | C/C(=N/NC(=O)Nc1nc(-c2ccccc2)cs1)c1ccc(O)cc1O.C/C(=N/NC(=O)Nc1nc(-c2ccccc2)cs1)c1ccc(O)cc1O.[Cu] |
| InChI | InChI=1S/2C18H16N4O3S.Cu/c2*1-11(14-8-7-13(23)9-16(14)24)21-22-17(25)20-18-19-15(10-26-18)12-5-3-2-4-6-12;/h2*2-10,23-24H,1H3,(H2,19,20,22,25);/b2*21-11-; |
| InChIKey | OHOIGHYGDOGNKT-CNNMDHGUSA-N |
| XLogP | 7.53 |
| TPSA | 213.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.38 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|