C18H15ClN4O2SZn — CID 24895749
chlorozinc(1+);4-methyl-2-[(E)-[(4-phenyl-1,3-thiazol-2-yl)carbamoylhydrazinylidene]methyl]phenolate (PubChem CID 24895749) has the molecular formula C18H15ClN4O2SZn and a molecular weight of 452.25 g/mol. Its IUPAC name is chlorozinc(1+);4-methyl-2-[(E)-[(4-phenyl-1,3-thiazol-2-yl)carbamoylhydrazinylidene]methyl]phenolate.
| Compound Name | chlorozinc(1+);4-methyl-2-[(E)-[(4-phenyl-1,3-thiazol-2-yl)carbamoylhydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 24895749 |
| Molecular Formula | C18H15ClN4O2SZn |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | chlorozinc(1+);4-methyl-2-[(E)-[(4-phenyl-1,3-thiazol-2-yl)carbamoylhydrazinylidene]methyl]phenolate |
| SMILES | Cc1ccc([O-])c(/C=N/NC(=O)Nc2nc(-c3ccccc3)cs2)c1.Cl[Zn+] |
| InChI | InChI=1S/C18H16N4O2S.ClH.Zn/c1-12-7-8-16(23)14(9-12)10-19-22-17(24)21-18-20-15(11-25-18)13-5-3-2-4-6-13;;/h2-11,23H,1H3,(H2,20,21,22,24);1H;/q;;+2/p-2/b19-10+;; |
| InChIKey | PRXDOSXVKNJLRY-DLFBYYCRSA-L |
| XLogP | 4.03 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|