C19H16FN3O2S — CID 146215730
(Z)-3-(2-fluoro-4-hydroxyphenyl)-2-(methylamino)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 146215730) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is (Z)-3-(2-fluoro-4-hydroxyphenyl)-2-(methylamino)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-(2-fluoro-4-hydroxyphenyl)-2-(methylamino)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 146215730 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | (Z)-3-(2-fluoro-4-hydroxyphenyl)-2-(methylamino)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CN/C(=C\c1ccc(O)cc1F)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H16FN3O2S/c1-21-16(9-13-7-8-14(24)10-15(13)20)18(25)23-19-22-17(11-26-19)12-5-3-2-4-6-12/h2-11,21,24H,1H3,(H,22,23,25)/b16-9- |
| InChIKey | ISOJGBKOFHLGGI-SXGWCWSVSA-N |
| XLogP | 3.85 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|