C23H19N3O4 — CID 135413470
(Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)-3-hydroxy-N,3-diphenylprop-2-enamide (PubChem CID 135413470) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is (Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)-3-hydroxy-N,3-diphenylprop-2-enamide.
| Compound Name | (Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)-3-hydroxy-N,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 135413470 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)-3-hydroxy-N,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1ccccc1)C(/N=N/c1ccc2c(c1)OCCO2)=C(/O)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O4/c27-22(16-7-3-1-4-8-16)21(23(28)24-17-9-5-2-6-10-17)26-25-18-11-12-19-20(15-18)30-14-13-29-19/h1-12,15,27H,13-14H2,(H,24,28)/b22-21-,26-25+ |
| InChIKey | AWOMCHZCQTUZOY-YRMNOKGTSA-N |
| XLogP | 5.11 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|