C26H25ClN4OSi — CID 135415191
[chloro(dimethyl)silyl] N'-[(Z)-[(E)-1-phenyl-3-(2-phenyl-1H-indol-3-yl)prop-2-enylidene]amino]carbamimidate (PubChem CID 135415191) has the molecular formula C26H25ClN4OSi and a molecular weight of 473.05 g/mol. Its IUPAC name is [chloro(dimethyl)silyl] N'-[(Z)-[(E)-1-phenyl-3-(2-phenyl-1H-indol-3-yl)prop-2-enylidene]amino]carbamimidate.
| Compound Name | [chloro(dimethyl)silyl] N'-[(Z)-[(E)-1-phenyl-3-(2-phenyl-1H-indol-3-yl)prop-2-enylidene]amino]carbamimidate |
|---|---|
| PubChem CID | 135415191 |
| Molecular Formula | C26H25ClN4OSi |
| Molecular Weight | 473.05 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [chloro(dimethyl)silyl] N'-[(Z)-[(E)-1-phenyl-3-(2-phenyl-1H-indol-3-yl)prop-2-enylidene]amino]carbamimidate |
| SMILES | C[Si](C)(Cl)O/C(N)=N/N=C(/C=C/c1c(-c2ccccc2)[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H25ClN4OSi/c1-33(2,27)32-26(28)31-30-23(19-11-5-3-6-12-19)18-17-22-21-15-9-10-16-24(21)29-25(22)20-13-7-4-8-14-20/h3-18,29H,1-2H3,(H2,28,31)/b18-17+,30-23- |
| InChIKey | ZTOVTGVXNNBKEZ-MCNYRKRBSA-N |
| XLogP | 6.52 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.05 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|