C12H7Cl2N5O2 — CID 135416496
2-amino-9-(2,4-dichlorobenzoyl)-1H-purin-6-one (PubChem CID 135416496) has the molecular formula C12H7Cl2N5O2 and a molecular weight of 324.13 g/mol. Its IUPAC name is 2-amino-9-(2,4-dichlorobenzoyl)-1H-purin-6-one.
| Compound Name | 2-amino-9-(2,4-dichlorobenzoyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135416496 |
| Molecular Formula | C12H7Cl2N5O2 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 2-amino-9-(2,4-dichlorobenzoyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C(=O)c2ccc(Cl)cc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C12H7Cl2N5O2/c13-5-1-2-6(7(14)3-5)11(21)19-4-16-8-9(19)17-12(15)18-10(8)20/h1-4H,(H3,15,17,18,20) |
| InChIKey | BGLQMWHMCABDMU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |