C8H7N5O2 — CID 175161679
2-amino-9-prop-2-enoyl-1H-purin-6-one (PubChem CID 175161679) has the molecular formula C8H7N5O2 and a molecular weight of 205.18 g/mol. Its IUPAC name is 2-amino-9-prop-2-enoyl-1H-purin-6-one.
| Compound Name | 2-amino-9-prop-2-enoyl-1H-purin-6-one |
|---|---|
| PubChem CID | 175161679 |
| Molecular Formula | C8H7N5O2 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2-amino-9-prop-2-enoyl-1H-purin-6-one |
| SMILES | C=CC(=O)n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C8H7N5O2/c1-2-4(14)13-3-10-5-6(13)11-8(9)12-7(5)15/h2-3H,1H2,(H3,9,11,12,15) |
| InChIKey | KAOWRJDMYWIMRT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|