C26H22N2O5 — CID 135418646
methyl (3E)-3-[hydroxy(phenyl)methylidene]-5-(N-methylanilino)-4,5-dioxo-2-phenyliminopentanoate (PubChem CID 135418646) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is methyl (3E)-3-[hydroxy(phenyl)methylidene]-5-(N-methylanilino)-4,5-dioxo-2-phenyliminopentanoate.
| Compound Name | methyl (3E)-3-[hydroxy(phenyl)methylidene]-5-(N-methylanilino)-4,5-dioxo-2-phenyliminopentanoate |
|---|---|
| PubChem CID | 135418646 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | methyl (3E)-3-[hydroxy(phenyl)methylidene]-5-(N-methylanilino)-4,5-dioxo-2-phenyliminopentanoate |
| SMILES | COC(=O)C(=N\c1ccccc1)/C(C(=O)C(=O)N(C)c1ccccc1)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C26H22N2O5/c1-28(20-16-10-5-11-17-20)25(31)24(30)21(23(29)18-12-6-3-7-13-18)22(26(32)33-2)27-19-14-8-4-9-15-19/h3-17,29H,1-2H3/b23-21+,27-22- |
| InChIKey | XWZZYVLQXFNALO-RMHGVJGPSA-N |
| XLogP | 4.13 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|