C12H17N3O — CID 135418903
1-tert-butyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135418903) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-tert-butyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 1-tert-butyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135418903 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-tert-butyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1cc(=O)[nH]c2c1c(C)nn2C(C)(C)C |
| InChI | InChI=1S/C12H17N3O/c1-7-6-9(16)13-11-10(7)8(2)14-15(11)12(3,4)5/h6H,1-5H3,(H,13,16) |
| InChIKey | BORLYRGBWLESFG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |