C18H26N2O2S — CID 135419252
2,6-ditert-butyl-4-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)phenol (PubChem CID 135419252) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)phenol |
|---|---|
| PubChem CID | 135419252 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2,6-ditert-butyl-4-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)phenol |
| SMILES | CCSc1nnc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)o1 |
| InChI | InChI=1S/C18H26N2O2S/c1-8-23-16-20-19-15(22-16)11-9-12(17(2,3)4)14(21)13(10-11)18(5,6)7/h9-10,21H,8H2,1-7H3 |
| InChIKey | MIOCGGZLPFHSEZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |