C27H40N4O4S — CID 135421362
tert-butyl N-[2-[3-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-2-phenylethylidene]amino]propylcarbamothioylamino]ethyl]carbamate (PubChem CID 135421362) has the molecular formula C27H40N4O4S and a molecular weight of 516.71 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-2-phenylethylidene]amino]propylcarbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-2-phenylethylidene]amino]propylcarbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 135421362 |
| Molecular Formula | C27H40N4O4S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | tert-butyl N-[2-[3-[[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-2-phenylethylidene]amino]propylcarbamothioylamino]ethyl]carbamate |
| SMILES | CC1(C)CC(=O)C(/C(Cc2ccccc2)=N/CCCNC(=S)NCCNC(=O)OC(C)(C)C)=C(O)C1 |
| InChI | InChI=1S/C27H40N4O4S/c1-26(2,3)35-25(34)31-15-14-30-24(36)29-13-9-12-28-20(16-19-10-7-6-8-11-19)23-21(32)17-27(4,5)18-22(23)33/h6-8,10-11,32H,9,12-18H2,1-5H3,(H,31,34)(H2,29,30,36)/b28-20+ |
| InChIKey | KHRAWESRVONOCY-VFCFBJKWSA-N |
| XLogP | 4.25 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|