C21H33N3O4 — CID 166488428
tert-butyl N-[2-[[(E)-4-amino-3-formyl-1-phenylbut-3-en-2-ylidene]amino]ethyl]carbamate;methoxyethane (PubChem CID 166488428) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is tert-butyl N-[2-[[(E)-4-amino-3-formyl-1-phenylbut-3-en-2-ylidene]amino]ethyl]carbamate;methoxyethane.
| Compound Name | tert-butyl N-[2-[[(E)-4-amino-3-formyl-1-phenylbut-3-en-2-ylidene]amino]ethyl]carbamate;methoxyethane |
|---|---|
| PubChem CID | 166488428 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tert-butyl N-[2-[[(E)-4-amino-3-formyl-1-phenylbut-3-en-2-ylidene]amino]ethyl]carbamate;methoxyethane |
| SMILES | CC(C)(C)OC(=O)NCC/N=C(Cc1ccccc1)\C(C=O)=C/N.CCOC |
| InChI | InChI=1S/C18H25N3O3.C3H8O/c1-18(2,3)24-17(23)21-10-9-20-16(15(12-19)13-22)11-14-7-5-4-6-8-14;1-3-4-2/h4-8,12-13H,9-11,19H2,1-3H3,(H,21,23);3H2,1-2H3/b15-12-,20-16-; |
| InChIKey | NFCXLVQFWDJXLU-ZJEMYWHLSA-N |
| XLogP | 2.89 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|