C16H14ClN5O3 — CID 135424956
4-amino-N'-(3-chloro-4-phenylmethoxyphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135424956) has the molecular formula C16H14ClN5O3 and a molecular weight of 359.77 g/mol. Its IUPAC name is 4-amino-N'-(3-chloro-4-phenylmethoxyphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-(3-chloro-4-phenylmethoxyphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135424956 |
| Molecular Formula | C16H14ClN5O3 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-amino-N'-(3-chloro-4-phenylmethoxyphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Nc1nonc1/C(=N/c1ccc(OCc2ccccc2)c(Cl)c1)NO |
| InChI | InChI=1S/C16H14ClN5O3/c17-12-8-11(19-16(20-23)14-15(18)22-25-21-14)6-7-13(12)24-9-10-4-2-1-3-5-10/h1-8,23H,9H2,(H2,18,22)(H,19,20) |
| InChIKey | OUTNSHXHLWICHL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|