C20H16ClFN2O2 — CID 24994860
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-phenylmethoxybenzenecarboximidamide (PubChem CID 24994860) has the molecular formula C20H16ClFN2O2 and a molecular weight of 370.81 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-phenylmethoxybenzenecarboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-phenylmethoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 24994860 |
| Molecular Formula | C20H16ClFN2O2 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-phenylmethoxybenzenecarboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H16ClFN2O2/c21-18-12-16(8-11-19(18)22)23-20(24-25)15-6-9-17(10-7-15)26-13-14-4-2-1-3-5-14/h1-12,25H,13H2,(H,23,24) |
| InChIKey | OUXKPBKZNGBEOH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|