C19H16IN5O2S — CID 135426744
3-benzyl-6-iodo-2-[(5-oxo-4,6-dihydro-1H-1,2,4-triazin-3-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 135426744) has the molecular formula C19H16IN5O2S and a molecular weight of 505.34 g/mol. Its IUPAC name is 3-benzyl-6-iodo-2-[(5-oxo-4,6-dihydro-1H-1,2,4-triazin-3-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-benzyl-6-iodo-2-[(5-oxo-4,6-dihydro-1H-1,2,4-triazin-3-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 135426744 |
| Molecular Formula | C19H16IN5O2S |
| Molecular Weight | 505.34 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | 3-benzyl-6-iodo-2-[(5-oxo-4,6-dihydro-1H-1,2,4-triazin-3-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | O=C1CNN=C(CSc2nc3ccc(I)cc3c(=O)n2Cc2ccccc2)N1 |
| InChI | InChI=1S/C19H16IN5O2S/c20-13-6-7-15-14(8-13)18(27)25(10-12-4-2-1-3-5-12)19(22-15)28-11-16-23-17(26)9-21-24-16/h1-8,21H,9-11H2,(H,23,24,26) |
| InChIKey | YZGXSJNQTHPFLH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|