C20H18N4O7S — CID 135428012
[(2S,4R,5R)-4-acetyloxy-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-methylideneoxolan-2-yl]methyl benzoate (PubChem CID 135428012) has the molecular formula C20H18N4O7S and a molecular weight of 458.45 g/mol. Its IUPAC name is [(2S,4R,5R)-4-acetyloxy-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-methylideneoxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,4R,5R)-4-acetyloxy-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-methylideneoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 135428012 |
| Molecular Formula | C20H18N4O7S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | [(2S,4R,5R)-4-acetyloxy-5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-methylideneoxolan-2-yl]methyl benzoate |
| SMILES | C=C1[C@@H](OC(C)=O)[C@H](n2c(=O)sc3c(=O)[nH]c(N)nc32)O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18N4O7S/c1-9-12(8-29-18(27)11-6-4-3-5-7-11)31-17(13(9)30-10(2)25)24-15-14(32-20(24)28)16(26)23-19(21)22-15/h3-7,12-13,17H,1,8H2,2H3,(H3,21,22,23,26)/t12-,13-,17-/m1/s1 |
| InChIKey | ZSNLYPPMNURSHR-PBFPGSCMSA-N |
| XLogP | 0.97 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|