C6H14N4O2 — CID 135438691
1-N',2-N'-dihydroxy-1-N,1-N,2-N,2-N-tetramethylethanediimidamide (PubChem CID 135438691) has the molecular formula C6H14N4O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-N',2-N'-dihydroxy-1-N,1-N,2-N,2-N-tetramethylethanediimidamide.
| Compound Name | 1-N',2-N'-dihydroxy-1-N,1-N,2-N,2-N-tetramethylethanediimidamide |
|---|---|
| PubChem CID | 135438691 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 1-N',2-N'-dihydroxy-1-N,1-N,2-N,2-N-tetramethylethanediimidamide |
| SMILES | CN(C)C(=NO)C(=NO)N(C)C |
| InChI | InChI=1S/C6H14N4O2/c1-9(2)5(7-11)6(8-12)10(3)4/h11-12H,1-4H3 |
| InChIKey | DJBGDNBFQRRQCX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|