C20H44N8NiO4 — CID 135534845
nickel;bis(1-N,1-N,2-N,2-N-tetraethyl-1-N',2-N'-dihydroxyethanediimidamide) (PubChem CID 135534845) has the molecular formula C20H44N8NiO4 and a molecular weight of 519.32 g/mol. Its IUPAC name is nickel;bis(1-N,1-N,2-N,2-N-tetraethyl-1-N',2-N'-dihydroxyethanediimidamide).
| Compound Name | nickel;bis(1-N,1-N,2-N,2-N-tetraethyl-1-N',2-N'-dihydroxyethanediimidamide) |
|---|---|
| PubChem CID | 135534845 |
| Molecular Formula | C20H44N8NiO4 |
| Molecular Weight | 519.32 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | nickel;bis(1-N,1-N,2-N,2-N-tetraethyl-1-N',2-N'-dihydroxyethanediimidamide) |
| SMILES | CCN(CC)C(=NO)C(=NO)N(CC)CC.CCN(CC)C(=NO)C(=NO)N(CC)CC.[Ni] |
| InChI | InChI=1S/2C10H22N4O2.Ni/c2*1-5-13(6-2)9(11-15)10(12-16)14(7-3)8-4;/h2*15-16H,5-8H2,1-4H3; |
| InChIKey | ZPAROFDZZRPALL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 143.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|