C19H16N2O — CID 135442808
(1E)-1-(10,15-dimethyl-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12,14-octaen-16-ylidene)ethanol (PubChem CID 135442808) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is (1E)-1-(10,15-dimethyl-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12,14-octaen-16-ylidene)ethanol.
| Compound Name | (1E)-1-(10,15-dimethyl-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12,14-octaen-16-ylidene)ethanol |
|---|---|
| PubChem CID | 135442808 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (1E)-1-(10,15-dimethyl-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12,14-octaen-16-ylidene)ethanol |
| SMILES | C/C(O)=c1\c(C)nc2ccc(C)c3nc4ccccc4c1c23 |
| InChI | InChI=1S/C19H16N2O/c1-10-8-9-15-18-17(16(12(3)22)11(2)20-15)13-6-4-5-7-14(13)21-19(10)18/h4-9,22H,1-3H3/b16-12- |
| InChIKey | SEMDECICRRXLPQ-VBKFSLOCSA-N |
| XLogP | 3.96 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|