C11H12N2O3 — CID 135443931
(2E,4R,5S)-4-methyl-2-(nitromethylidene)-5-phenyl-1,3-oxazolidine (PubChem CID 135443931) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is (2E,4R,5S)-4-methyl-2-(nitromethylidene)-5-phenyl-1,3-oxazolidine.
| Compound Name | (2E,4R,5S)-4-methyl-2-(nitromethylidene)-5-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 135443931 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (2E,4R,5S)-4-methyl-2-(nitromethylidene)-5-phenyl-1,3-oxazolidine |
| SMILES | C[C@H]1N/C(=C\[N+](=O)[O-])O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H12N2O3/c1-8-11(9-5-3-2-4-6-9)16-10(12-8)7-13(14)15/h2-8,11-12H,1H3/b10-7+/t8-,11-/m1/s1 |
| InChIKey | YBWSCWDSYSPJJY-IAFAVEBVSA-N |
| XLogP | 1.81 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|