C17H11NO3 — CID 135449109
2-(6-hydroxynaphthalen-2-yl)-1,3-benzoxazol-6-ol (PubChem CID 135449109) has the molecular formula C17H11NO3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-(6-hydroxynaphthalen-2-yl)-1,3-benzoxazol-6-ol.
| Compound Name | 2-(6-hydroxynaphthalen-2-yl)-1,3-benzoxazol-6-ol |
|---|---|
| PubChem CID | 135449109 |
| Molecular Formula | C17H11NO3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-(6-hydroxynaphthalen-2-yl)-1,3-benzoxazol-6-ol |
| SMILES | Oc1ccc2cc(-c3nc4ccc(O)cc4o3)ccc2c1 |
| InChI | InChI=1S/C17H11NO3/c19-13-4-3-10-7-12(2-1-11(10)8-13)17-18-15-6-5-14(20)9-16(15)21-17/h1-9,19-20H |
| InChIKey | PZIKVWJRAOMJDU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |