C26H27ClN2O6 — CID 135450115
(4Z)-4-[(3-ethyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraene perchlorate (PubChem CID 135450115) has the molecular formula C26H27ClN2O6 and a molecular weight of 498.96 g/mol. Its IUPAC name is (4Z)-4-[(3-ethyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraene perchlorate.
| Compound Name | (4Z)-4-[(3-ethyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraene perchlorate |
|---|---|
| PubChem CID | 135450115 |
| Molecular Formula | C26H27ClN2O6 |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (4Z)-4-[(3-ethyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraene perchlorate |
| SMILES | CC[n+]1c(/C=C2/C=C(C)c3cc4c5c(c3O2)CCCN5CCC4)oc2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C26H27N2O2.ClHO4/c1-3-28-22-10-4-5-11-23(22)30-24(28)16-19-14-17(2)21-15-18-8-6-12-27-13-7-9-20(25(18)27)26(21)29-19;2-1(3,4)5/h4-5,10-11,14-16H,3,6-9,12-13H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HDONSOXDJOJHMD-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 121.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|