C32H28N4O2 — CID 72594724
2-(1H-benzimidazol-2-yl)-2-[2-methyl-6-[(6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-ylidene)methyl]pyran-4-ylidene]acetonitrile (PubChem CID 72594724) has the molecular formula C32H28N4O2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-2-[2-methyl-6-[(6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-ylidene)methyl]pyran-4-ylidene]acetonitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-2-[2-methyl-6-[(6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-ylidene)methyl]pyran-4-ylidene]acetonitrile |
|---|---|
| PubChem CID | 72594724 |
| Molecular Formula | C32H28N4O2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-2-[2-methyl-6-[(6-methyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-ylidene)methyl]pyran-4-ylidene]acetonitrile |
| SMILES | CC1=CC(=C(C#N)c2nc3ccccc3[nH]2)C=C(C=C2C=C(C)c3cc4c5c(c3O2)CCCN5CCC4)O1 |
| InChI | InChI=1S/C32H28N4O2/c1-19-13-23(38-31-25-8-6-12-36-11-5-7-21(30(25)36)16-26(19)31)17-24-15-22(14-20(2)37-24)27(18-33)32-34-28-9-3-4-10-29(28)35-32/h3-4,9-10,13-17H,5-8,11-12H2,1-2H3,(H,34,35) |
| InChIKey | OIQIYFXKCGLHOC-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|