C26H23FN4O5S — CID 135454960
N-[(1R)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-diazo-1-(4-fluorophenyl)-3-oxopropyl]-4-methylbenzenesulfonamide (PubChem CID 135454960) has the molecular formula C26H23FN4O5S and a molecular weight of 522.56 g/mol. Its IUPAC name is N-[(1R)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-diazo-1-(4-fluorophenyl)-3-oxopropyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-diazo-1-(4-fluorophenyl)-3-oxopropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135454960 |
| Molecular Formula | C26H23FN4O5S |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | N-[(1R)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-diazo-1-(4-fluorophenyl)-3-oxopropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C(=[N+]=[N-])C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H23FN4O5S/c1-17-7-13-22(14-8-17)37(34,35)30-23(19-9-11-20(27)12-10-19)24(29-28)25(32)31-21(16-36-26(31)33)15-18-5-3-2-4-6-18/h2-14,21,23,30H,15-16H2,1H3/t21-,23+/m0/s1 |
| InChIKey | PUFSLEUHIDAAHA-JTHBVZDNSA-N |
| XLogP | 3.41 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|