C13H14IN3O4 — CID 135459590
ethyl N-[3-hydroxy-2-[(5-iodo-2-pyridinyl)iminomethyl]but-2-enoyl]carbamate (PubChem CID 135459590) has the molecular formula C13H14IN3O4 and a molecular weight of 403.18 g/mol. Its IUPAC name is ethyl N-[3-hydroxy-2-[(5-iodo-2-pyridinyl)iminomethyl]but-2-enoyl]carbamate.
| Compound Name | ethyl N-[3-hydroxy-2-[(5-iodo-2-pyridinyl)iminomethyl]but-2-enoyl]carbamate |
|---|---|
| PubChem CID | 135459590 |
| Molecular Formula | C13H14IN3O4 |
| Molecular Weight | 403.18 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | ethyl N-[3-hydroxy-2-[(5-iodo-2-pyridinyl)iminomethyl]but-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(/C=N/c1ccc(I)cn1)=C(C)O |
| InChI | InChI=1S/C13H14IN3O4/c1-3-21-13(20)17-12(19)10(8(2)18)7-16-11-5-4-9(14)6-15-11/h4-7,18H,3H2,1-2H3,(H,17,19,20)/b10-8?,16-7+ |
| InChIKey | MYLQVBRGAHPFEX-LITAPJBQSA-N |
| XLogP | 2.49 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|