C6H7N5O — CID 135463572
6-imino-1-methyl-7,9-dihydropurin-8-one (PubChem CID 135463572) has the molecular formula C6H7N5O and a molecular weight of 165.16 g/mol. Its IUPAC name is 6-imino-1-methyl-7,9-dihydropurin-8-one.
| Compound Name | 6-imino-1-methyl-7,9-dihydropurin-8-one |
|---|---|
| PubChem CID | 135463572 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 6-imino-1-methyl-7,9-dihydropurin-8-one |
| SMILES | [H]/N=c1/c2[nH]c(=O)[nH]c2ncn1C |
| InChI | InChI=1S/C6H7N5O/c1-11-2-8-5-3(4(11)7)9-6(12)10-5/h2,7H,1H3,(H2,9,10,12)/b7-4- |
| InChIKey | HKWSSDSLAPRKKJ-DAXSKMNVSA-N |
| XLogP | -0.93 |
| TPSA | 90.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |