C16H18FN5O2S — CID 135468825
2-amino-9-[[1-fluoro-3-(4-methylphenyl)sulfanylpropan-2-yl]oxymethyl]-1H-purin-6-one (PubChem CID 135468825) has the molecular formula C16H18FN5O2S and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-amino-9-[[1-fluoro-3-(4-methylphenyl)sulfanylpropan-2-yl]oxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[[1-fluoro-3-(4-methylphenyl)sulfanylpropan-2-yl]oxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135468825 |
| Molecular Formula | C16H18FN5O2S |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-amino-9-[[1-fluoro-3-(4-methylphenyl)sulfanylpropan-2-yl]oxymethyl]-1H-purin-6-one |
| SMILES | Cc1ccc(SCC(CF)OCn2cnc3c(=O)[nH]c(N)nc32)cc1 |
| InChI | InChI=1S/C16H18FN5O2S/c1-10-2-4-12(5-3-10)25-7-11(6-17)24-9-22-8-19-13-14(22)20-16(18)21-15(13)23/h2-5,8,11H,6-7,9H2,1H3,(H3,18,20,21,23) |
| InChIKey | DYDPKGNNQJBRCM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |