C20H21N5O4 — CID 135471279
N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 135471279) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135471279 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(NC(=O)c3cccc[n+]3[O-])cc2)no1 |
| InChI | InChI=1S/C20H21N5O4/c1-20(2,3)16-12-17(24-29-16)23-19(27)22-14-9-7-13(8-10-14)21-18(26)15-6-4-5-11-25(15)28/h4-12H,1-3H3,(H,21,26)(H2,22,23,24,27) |
| InChIKey | YKFLKKGSFABCAW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|