C19H18F6N2 — CID 135475255
N-[(Z)-cyclohexa-2,4-dien-1-ylidene-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)methyl]-2,4,6-trimethylaniline (PubChem CID 135475255) has the molecular formula C19H18F6N2 and a molecular weight of 388.36 g/mol. Its IUPAC name is N-[(Z)-cyclohexa-2,4-dien-1-ylidene-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)methyl]-2,4,6-trimethylaniline.
| Compound Name | N-[(Z)-cyclohexa-2,4-dien-1-ylidene-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)methyl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 135475255 |
| Molecular Formula | C19H18F6N2 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-[(Z)-cyclohexa-2,4-dien-1-ylidene-(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino)methyl]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(N/C(N=C(C(F)(F)F)C(F)(F)F)=C2/C=CC=CC2)c(C)c1 |
| InChI | InChI=1S/C19H18F6N2/c1-11-9-12(2)15(13(3)10-11)26-16(14-7-5-4-6-8-14)27-17(18(20,21)22)19(23,24)25/h4-7,9-10,26H,8H2,1-3H3/b16-14+ |
| InChIKey | XSZZCTIMSRPCNO-JQIJEIRASA-N |
| XLogP | 6.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|