C15H19N5O — CID 135475538
6-methyl-3-[(2Z)-2-(1-phenylpentylidene)hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135475538) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 6-methyl-3-[(2Z)-2-(1-phenylpentylidene)hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-[(2Z)-2-(1-phenylpentylidene)hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135475538 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 6-methyl-3-[(2Z)-2-(1-phenylpentylidene)hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | CCCC/C(=N/Nc1nnc(C)c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C15H19N5O/c1-3-4-10-13(12-8-6-5-7-9-12)18-20-15-16-14(21)11(2)17-19-15/h5-9H,3-4,10H2,1-2H3,(H2,16,19,20,21)/b18-13- |
| InChIKey | GOGVHKPMDDBQDD-AQTBWJFISA-N |
| XLogP | 2.48 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|