C61H57N5O2 — CID 135476020
tert-butyl N-[4-[10,20-bis(4-methylphenyl)-15-[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]carbamate (PubChem CID 135476020) has the molecular formula C61H57N5O2 and a molecular weight of 892.16 g/mol. Its IUPAC name is tert-butyl N-[4-[10,20-bis(4-methylphenyl)-15-[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[10,20-bis(4-methylphenyl)-15-[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 135476020 |
| Molecular Formula | C61H57N5O2 |
| Molecular Weight | 892.16 g/mol |
| Exact Mass | 891.45 |
| IUPAC Name | tert-butyl N-[4-[10,20-bis(4-methylphenyl)-15-[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]carbamate |
| SMILES | C=CCC(CC=C)(CC=C)c1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(NC(=O)OC(C)(C)C)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C61H57N5O2/c1-9-36-61(37-10-2,38-11-3)45-24-20-43(21-25-45)57-51-32-28-47(63-51)55(41-16-12-39(4)13-17-41)49-30-34-53(65-49)58(44-22-26-46(27-23-44)62-59(67)68-60(6,7)8)54-35-31-50(66-54)56(48-29-33-52(57)64-48)42-18-14-40(5)15-19-42/h9-35,63,66H,1-3,36-38H2,4-8H3,(H,62,67)/b55-47-,55-49-,56-48-,56-50-,57-51-,57-52-,58-53-,58-54- |
| InChIKey | HCKKINVFMAJKNA-UJNHEQPASA-N |
| XLogP | 16.25 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.16 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|