C10H6ClF2N3O — CID 135480650
2-amino-5-chloro-4-(2,3-difluorophenyl)-1H-pyrimidin-6-one (PubChem CID 135480650) has the molecular formula C10H6ClF2N3O and a molecular weight of 257.63 g/mol. Its IUPAC name is 2-amino-5-chloro-4-(2,3-difluorophenyl)-1H-pyrimidin-6-one.
| Compound Name | 2-amino-5-chloro-4-(2,3-difluorophenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135480650 |
| Molecular Formula | C10H6ClF2N3O |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2-amino-5-chloro-4-(2,3-difluorophenyl)-1H-pyrimidin-6-one |
| SMILES | Nc1nc(-c2cccc(F)c2F)c(Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C10H6ClF2N3O/c11-6-8(15-10(14)16-9(6)17)4-2-1-3-5(12)7(4)13/h1-3H,(H3,14,15,16,17) |
| InChIKey | URZJSUAABZSCNJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |