C28H28N2O — CID 135484630
4-[1-[4-(2-methylpropyl)phenyl]-2-phenylethyl]-2-phenyl-1H-pyrimidin-6-one (PubChem CID 135484630) has the molecular formula C28H28N2O and a molecular weight of 408.55 g/mol. Its IUPAC name is 4-[1-[4-(2-methylpropyl)phenyl]-2-phenylethyl]-2-phenyl-1H-pyrimidin-6-one.
| Compound Name | 4-[1-[4-(2-methylpropyl)phenyl]-2-phenylethyl]-2-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135484630 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-[1-[4-(2-methylpropyl)phenyl]-2-phenylethyl]-2-phenyl-1H-pyrimidin-6-one |
| SMILES | CC(C)Cc1ccc(C(Cc2ccccc2)c2cc(=O)[nH]c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C28H28N2O/c1-20(2)17-22-13-15-23(16-14-22)25(18-21-9-5-3-6-10-21)26-19-27(31)30-28(29-26)24-11-7-4-8-12-24/h3-16,19-20,25H,17-18H2,1-2H3,(H,29,30,31) |
| InChIKey | XUKZAJDYBVHXKI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |