C16H31N7O — CID 135490745
4,6-bis(dipropylamino)-N'-hydroxy-1,3,5-triazine-2-carboximidamide (PubChem CID 135490745) has the molecular formula C16H31N7O and a molecular weight of 337.47 g/mol. Its IUPAC name is 4,6-bis(dipropylamino)-N'-hydroxy-1,3,5-triazine-2-carboximidamide.
| Compound Name | 4,6-bis(dipropylamino)-N'-hydroxy-1,3,5-triazine-2-carboximidamide |
|---|---|
| PubChem CID | 135490745 |
| Molecular Formula | C16H31N7O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 4,6-bis(dipropylamino)-N'-hydroxy-1,3,5-triazine-2-carboximidamide |
| SMILES | CCCN(CCC)c1nc(/C(N)=N\O)nc(N(CCC)CCC)n1 |
| InChI | InChI=1S/C16H31N7O/c1-5-9-22(10-6-2)15-18-14(13(17)21-24)19-16(20-15)23(11-7-3)12-8-4/h24H,5-12H2,1-4H3,(H2,17,21) |
| InChIKey | NLLFQTUQSCTKOJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|