C5H8N4O2 — CID 135489940
5-ethyl-N'-hydroxy-1,2,4-oxadiazole-3-carboximidamide (PubChem CID 135489940) has the molecular formula C5H8N4O2 and a molecular weight of 156.15 g/mol. Its IUPAC name is 5-ethyl-N'-hydroxy-1,2,4-oxadiazole-3-carboximidamide.
| Compound Name | 5-ethyl-N'-hydroxy-1,2,4-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135489940 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 5-ethyl-N'-hydroxy-1,2,4-oxadiazole-3-carboximidamide |
| SMILES | CCc1nc(/C(N)=N\O)no1 |
| InChI | InChI=1S/C5H8N4O2/c1-2-3-7-5(9-11-3)4(6)8-10/h10H,2H2,1H3,(H2,6,8) |
| InChIKey | VLGPAIFKLCTJBX-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|