C22H22Cl2N2O3 — CID 135494050
N-(2,3-dichlorophenyl)-6-hexyl-7-hydroxy-2-iminochromene-3-carboxamide (PubChem CID 135494050) has the molecular formula C22H22Cl2N2O3 and a molecular weight of 433.34 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-6-hexyl-7-hydroxy-2-iminochromene-3-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-6-hexyl-7-hydroxy-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 135494050 |
| Molecular Formula | C22H22Cl2N2O3 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-(2,3-dichlorophenyl)-6-hexyl-7-hydroxy-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2cc(O)c(CCCCCC)cc2cc1C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H22Cl2N2O3/c1-2-3-4-5-7-13-10-14-11-15(21(25)29-19(14)12-18(13)27)22(28)26-17-9-6-8-16(23)20(17)24/h6,8-12,25,27H,2-5,7H2,1H3,(H,26,28)/b25-21- |
| InChIKey | LFBMBGIIYSWYFA-DAFNUICNSA-N |
| XLogP | 6.30 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|