C11H8N6O — CID 135495923
5-methyl-14-oxa-2,9,11,13,15,17-hexazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),4,6,9,12,15-heptaene (PubChem CID 135495923) has the molecular formula C11H8N6O and a molecular weight of 240.23 g/mol. Its IUPAC name is 5-methyl-14-oxa-2,9,11,13,15,17-hexazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),4,6,9,12,15-heptaene.
| Compound Name | 5-methyl-14-oxa-2,9,11,13,15,17-hexazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),4,6,9,12,15-heptaene |
|---|---|
| PubChem CID | 135495923 |
| Molecular Formula | C11H8N6O |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 5-methyl-14-oxa-2,9,11,13,15,17-hexazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),4,6,9,12,15-heptaene |
| SMILES | Cc1ccc2nc3c(nc2c1)Nc1nonc1N3 |
| InChI | InChI=1S/C11H8N6O/c1-5-2-3-6-7(4-5)13-9-8(12-6)14-10-11(15-9)17-18-16-10/h2-4H,1H3,(H,12,14,16)(H,13,15,17) |
| InChIKey | OCCMHQGQMJOFCS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |