C5H11N5O3 — CID 135498140
N-[5-(2-hydroxyethyl)-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 135498140) has the molecular formula C5H11N5O3 and a molecular weight of 189.17 g/mol. Its IUPAC name is N-[5-(2-hydroxyethyl)-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | N-[5-(2-hydroxyethyl)-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135498140 |
| Molecular Formula | C5H11N5O3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-[5-(2-hydroxyethyl)-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | O=[N+]([O-])N=C1NCN(CCO)CN1 |
| InChI | InChI=1S/C5H11N5O3/c11-2-1-9-3-6-5(7-4-9)8-10(12)13/h11H,1-4H2,(H2,6,7,8) |
| InChIKey | JNWOHVFXLUDLOU-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|