C12H16ClN5O3 — CID 135501642
(1S,2S,5S)-3-[(6-amino-7H-purin-9-ium-9-yl)methyl]-5-methoxycyclopent-3-ene-1,2-diol chloride (PubChem CID 135501642) has the molecular formula C12H16ClN5O3 and a molecular weight of 313.75 g/mol. Its IUPAC name is (1S,2S,5S)-3-[(6-amino-7H-purin-9-ium-9-yl)methyl]-5-methoxycyclopent-3-ene-1,2-diol chloride.
| Compound Name | (1S,2S,5S)-3-[(6-amino-7H-purin-9-ium-9-yl)methyl]-5-methoxycyclopent-3-ene-1,2-diol chloride |
|---|---|
| PubChem CID | 135501642 |
| Molecular Formula | C12H16ClN5O3 |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (1S,2S,5S)-3-[(6-amino-7H-purin-9-ium-9-yl)methyl]-5-methoxycyclopent-3-ene-1,2-diol chloride |
| SMILES | CO[C@H]1C=C(C[n+]2c[nH]c3c(N)ncnc32)[C@H](O)[C@@H]1O.[Cl-] |
| InChI | InChI=1S/C12H15N5O3.ClH/c1-20-7-2-6(9(18)10(7)19)3-17-5-16-8-11(13)14-4-15-12(8)17;/h2,4-5,7,9-10,18-19H,3H2,1H3,(H2,13,14,15);1H/t7-,9-,10+;/m0./s1 |
| InChIKey | JVAHVTKQYCENJV-AVZUWDKFSA-N |
| XLogP | -4.49 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|